| PubChem=1134 | SMILES=CC1=CN(C(=O)NC1=O)C2CC(C(O2)CO)O | MeSHName=Thymidine }} |Section2= |Section3= }} Thymidine (more precisely called deoxythymidine; can also be labelled deoxyribosylthymine, and thymine deoxyriboside)'s a chemical compound, more precisely a pyrimidine deoxynucleoside. Deoxythymidine's the DNA nucleoside T, which pairs with deoxyadenosine (A) in double-stranded DNA. In cell biology it's used to synchronize the cells in S phase. Before the boom in thymidine use caused by th… (More on Thymidine)