| ChemSpiderID = 2068 | ATC_prefix = R03 | ATC_suffix = DA04 | ATC_supplemental = | PubChem = 2153 | DrugBank = APRD00082 | smiles = CN1C(=O)N(C)c2nc[nH]c2C1=O | C=7 | H=8 | N=4 | O=2 | molecular_weight = 180.164 g/mol | bioavailability = 100% | protein_bound = 40%, primarily to albumin | metabolism = hepatic to 1-methyluric acid | elimination_half-life = 5-8 hours | pregnancy_AU = A | pregnancy_US = C | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = P | legal_US = Rx | legal_statu… (
More on Theophylline)