| PubChem=6518 | SMILES=C(C(CO[N+](=O)[O-])(CO[N+](=O)[O-])CO[N+](=O)[O-])O[N+](=O)[O-] }} |Section2= | Section3 = |Section4= }} Pentaerythritol tetranitrate (PETN, also known as corpent, pentrite, or rarely and primarily in German as nitropenta or pentrit),'s one of the most powerful high explosives known, with a relative effectiveness factor (R.E. factor) of 1.66. Uses The most obvious use of PETN's as an explosive. It's more sensitive to shock or friction than TNT or tetryl, and it's never… (More on Petn)