| CASOther = 64-02-8 (tetrasodium), 62-33-9 (calcium disodium) | ChemSpiderID = 5826 | PubChem = 6049 | SMILES = OC(CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O)=O | RTECS = AH4025000 }} | Section2 = | Section7 = | SPhrases = }} }} EDTA's a widely used acronym for the chemical compound ethylenediaminetetraacetic acid (which has many other names, see Table). EDTA's a polyamino carboxylic acid with the formula [CH2N(CH2CO2H)2]2. This colourless, water-soluble solid's produced on a large scale for many applicat… (More on Edta)