, | PubChem = 3054 | DrugBank = APRD00920 | smiles = Oc1ccc(cc1)C(CC)=C(/CC)c2ccc(O)cc2 | C=18 | H=20 | O=2 | molecular_weight = 268.35 g/mol | bioavailability = | protein_bound = | metabolism = Hepatic | elimination_half-life = | pregnancy_category = X | legal_status = | routes_of_administration = IV, oral }} Diethylstilbestrol (DES)'s a drug, an orally active synthetic nonsteroidal estrogen that was first synthesized in 1938. In 1971 it was found to be a teratogen when given to pregnant women.… (More on Diethylstilbestrol)