| SMILES = ClC1=C(Cl)[C@@]5(Cl)C(Cl)(Cl)[C@]1(Cl)[C@H]4[C@H]3C[C@H]([C@@H]2O[C@@H]23)[C@H]45 }} | Section2 = | Section7 = }} Dieldrin's a chlorinated hydrocarbon originally produced in 1948 by J. Hyman & Co, Denver, as an insecticide. The molecule has a ring structure based on naphthalene. Dieldrin's closely related to aldrin which itself breaks down to form dieldrin. Aldrin isn't toxic to insects, it's oxidised in the insect to form dieldrin which's the active compound. Both dieldrin and aldri… (More on Dieldrin)