| ChemSpiderID = 5775 | PubChem=5997 | SMILES=CC(C)CCCC(C)C1CCC2C1 (CCC3C2CC=C4C3(CCC(C4)O)C)C }} | Section2=, plays a larger role in blood cholesterol than intake of cholesterol itself. Saturated fat's present in full fat dairy products, animal fats, several types of oil and chocolate. Trans fats are derived from the partial hydrogenation of unsaturated fats, and in contrast to other types of fat, they aren't essential for life. It's recommended that trans fats be consumed extremely rarely or… (More on Cholesterol)