| ChemSpiderID = 2618 | ATC_prefix = P01 | ATC_suffix = BA01 | PubChem = 2719 | DrugBank = APRD00468 | C = 18 |H = 26 |Cl = 1 |N = 3 | molecular_weight = 319.872 g/mol | smiles = CCN(CC)CCCC(C)Nc1ccnc2cc(Cl)ccc12 | bioavailability = | protein_bound = | metabolism = Liver | elimination_half-life = 1-2 months | pregnancy_category = | legal_status = | routes_of_administration = }} Chloroquine's a 4-aminoquinoline drug used in the treatment or prevention of malaria. Uses It's long been used in the… (
More on Chloroquine)