| PubChem=6035 | SMILES=C1C(C(OC1N2C=C(C(=O)NC2=O)Br)CO)O | MeSHName=Bromodeoxyuridine }} |Section2= |Section3= }} Bromodeoxyuridine (5-bromo-2-deoxyuridine, BrdU)'s a synthetic nucleoside that's an analogue of thymidine. BrdU's commonly used in the detection of proliferating cells in living tissues. BrdU can be incorporated into the newly synthesized DNA of replicating cells (during the S phase of the cell cycle), substituting for thymidine during DNA replication. Antibodies specific for BrdU… (More on Brdu)