| RTECS = AL31500000 | ChemSpiderID = 175 | InChI=1/C3H6O/c1-3(2)4/h1-2H3 }} | Section2 = | Section3 = | Section7 = | NFPA-H = 1 | NFPA-F = 3 | NFPA-R = 0 | RPhrases =,,, | SPhrases =,,, | FlashPt = -17 °C | Autoignition = 465 °C | ExploLimits = 4.0–57.0 | LD50 = >2000 mg/kg, oral (rat) }} | Section8 = }} Acetone's the organic compound with the formula OC(CH3)2. This colorless, mobile, flammable liquid's the simplest example of the ketones. Owing to the fact that acetone's misc… (
More on Acetone)